Products 1260787-73-2
CAS 1260787-73-2 is the registry number for 1-[4-(trifluoromethoxy)phenyl]cyclopentane-1-carboxylic acid, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[4-(trifluoromethoxy)phenyl]cyclopentane-1-carboxylic acid (CAS 1260787-73-2) is a chemical compound with the molecular formula C13H13F3O3 and a molecular weight of 274.23 g/mol. IUPAC name: 1-[4-(trifluoromethoxy)phenyl]cyclopentane-1-carboxylic acid. InChIKey: LBPBHMJPWGABOD-UHFFFAOYSA-N.
| Molecular formula | C13H13F3O3 |
|---|---|
| Molecular weight | 274.23 g/mol |
| IUPAC name | 1-[4-(trifluoromethoxy)phenyl]cyclopentane-1-carboxylic acid |
| InChIKey | LBPBHMJPWGABOD-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=C(C=C2)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)