CAS 1260789-19-2 is the registry number for N-Methyl-1-(1-methyl-1,2,3,4-tetrahydro-6-quinolinyl)methanamine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.
N-methyl-1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methanamine;oxalic acid (CAS 1260789-19-2) is a chemical compound with the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. IUPAC name: N-methyl-1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methanamine;oxalic acid. InChIKey: DLXNYTCFHGZUHA-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O4 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | N-methyl-1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methanamine;oxalic acid |
| InChIKey | DLXNYTCFHGZUHA-UHFFFAOYSA-N |
| SMILES | CNCC1=CC2=C(C=C1)N(CCC2)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)