CAS 1260790-69-9 is the registry number for Ethyl 2-amino-5-bromo-4-chlorobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Ethyl 2-amino-5-bromo-4-chlorobenzoate (CAS 1260790-69-9) is a chemical compound with the molecular formula C9H9BrClNO2 and a molecular weight of 278.53 g/mol. IUPAC name: ethyl 2-amino-5-bromo-4-chlorobenzoate. InChIKey: WSDPTZSINKNKBS-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO2 |
|---|---|
| Molecular weight | 278.53 g/mol |
| IUPAC name | ethyl 2-amino-5-bromo-4-chlorobenzoate |
| InChIKey | WSDPTZSINKNKBS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1N)Cl)Br |
Computed by PubChem (NCBI)