CAS 25216-76-6 appears in our catalog under these names: 2-Chloroethyl n-(3-bromophenyl)carbamate, 95%, 2-Chloroethyl N-(3-bromophenyl)carbamate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-chloroethyl N-(3-bromophenyl)carbamate (CAS 25216-76-6) is a chemical compound with the molecular formula C9H9BrClNO2 and a molecular weight of 278.53 g/mol. IUPAC name: 2-chloroethyl N-(3-bromophenyl)carbamate. InChIKey: IIKCRHUVYQTOJD-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO2 |
|---|---|
| Molecular weight | 278.53 g/mol |
| IUPAC name | 2-chloroethyl N-(3-bromophenyl)carbamate |
| InChIKey | IIKCRHUVYQTOJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)NC(=O)OCCCl |
Computed by PubChem (NCBI)