CAS 2379322-68-4 is the registry number for Propyl 3-bromo-2-chloroisonicotinate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
Propyl 3-bromo-2-chloropyridine-4-carboxylate (CAS 2379322-68-4) is a chemical compound with the molecular formula C9H9BrClNO2 and a molecular weight of 278.53 g/mol. IUPAC name: propyl 3-bromo-2-chloropyridine-4-carboxylate. InChIKey: XPVKOMRQDIRROD-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClNO2 |
|---|---|
| Molecular weight | 278.53 g/mol |
| IUPAC name | propyl 3-bromo-2-chloropyridine-4-carboxylate |
| InChIKey | XPVKOMRQDIRROD-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C1=C(C(=NC=C1)Cl)Br |
Computed by PubChem (NCBI)