CAS 1260798-67-1 is the registry number for 5-(3-Fluorophenyl)-1,2,4-oxadiazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-(3-fluorophenyl)-1,2,4-oxadiazole-3-carboxylic acid (CAS 1260798-67-1) is a chemical compound with the molecular formula C9H5FN2O3 and a molecular weight of 208.15 g/mol. IUPAC name: 5-(3-fluorophenyl)-1,2,4-oxadiazole-3-carboxylic acid. InChIKey: DVGNFJFKBUFVGF-UHFFFAOYSA-N.
| Molecular formula | C9H5FN2O3 |
|---|---|
| Molecular weight | 208.15 g/mol |
| IUPAC name | 5-(3-fluorophenyl)-1,2,4-oxadiazole-3-carboxylic acid |
| InChIKey | DVGNFJFKBUFVGF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NC(=NO2)C(=O)O |
Computed by PubChem (NCBI)