CAS 1547299-34-2 is the registry number for 5-(5-Fluoropyridin-2-yl)isoxazole-3-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
5-(5-fluoro-2-pyridinyl)-1,2-oxazole-3-carboxylic acid (CAS 1547299-34-2) is a chemical compound with the molecular formula C9H5FN2O3 and a molecular weight of 208.15 g/mol. IUPAC name: 5-(5-fluoro-2-pyridinyl)-1,2-oxazole-3-carboxylic acid. InChIKey: SWIXOHWEMCAATB-UHFFFAOYSA-N.
| Molecular formula | C9H5FN2O3 |
|---|---|
| Molecular weight | 208.15 g/mol |
| IUPAC name | 5-(5-fluoro-2-pyridinyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | SWIXOHWEMCAATB-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1F)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)