CAS 944898-08-2 appears in our catalog under these names: 5-(4-Fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid, 98%, 5-(4-Fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 500mg.
5-(4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid (CAS 944898-08-2) is a chemical compound with the molecular formula C9H5FN2O3 and a molecular weight of 208.15 g/mol. IUPAC name: 5-(4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid. InChIKey: ATRZEFITCDULRJ-UHFFFAOYSA-N.
| Molecular formula | C9H5FN2O3 |
|---|---|
| Molecular weight | 208.15 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-1,3,4-oxadiazole-2-carboxylic acid |
| InChIKey | ATRZEFITCDULRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)C(=O)O)F |
Computed by PubChem (NCBI)