Products 1260812-63-2

CAS 1260812-63-2 is the registry number for Methyl 4–amino–2–fluoro–5–iodobenzoate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 4-amino-2-fluoro-5-iodobenzoate (CAS 1260812-63-2) is a chemical compound with the molecular formula C8H7FINO2 and a molecular weight of 295.05 g/mol. IUPAC name: methyl 4-amino-2-fluoro-5-iodobenzoate. InChIKey: CIJQZXFORFBFPX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7FINO2
Molecular weight295.05 g/mol
IUPAC namemethyl 4-amino-2-fluoro-5-iodobenzoate
InChIKeyCIJQZXFORFBFPX-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C=C1F)N)I

Computed by PubChem (NCBI)