CAS 1823565-63-4 appears in our catalog under these names: METHYL 2-AMINO-4-FLUORO-5-IODOBENZOATE, >95%, 2-Amino-4-fluoro-5-iodo-benzoic acid methyl ester, 95%, 2-Amino-4-fluoro-5-iodo-benzoic acid methyl ester, >95%, >95%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g.
Methyl 2-amino-4-fluoro-5-iodobenzoate (CAS 1823565-63-4) is a chemical compound with the molecular formula C8H7FINO2 and a molecular weight of 295.05 g/mol. IUPAC name: methyl 2-amino-4-fluoro-5-iodobenzoate. InChIKey: AQKDYPGTTAXJRF-UHFFFAOYSA-N.
| Molecular formula | C8H7FINO2 |
|---|---|
| Molecular weight | 295.05 g/mol |
| IUPAC name | methyl 2-amino-4-fluoro-5-iodobenzoate |
| InChIKey | AQKDYPGTTAXJRF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1N)F)I |
Computed by PubChem (NCBI)