Products 2092615-03-5

CAS 2092615-03-5 is the registry number for Methyl 3-amino-4-fluoro-5-iodobenzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 3-amino-4-fluoro-5-iodobenzoate (CAS 2092615-03-5) is a chemical compound with the molecular formula C8H7FINO2 and a molecular weight of 295.05 g/mol. IUPAC name: methyl 3-amino-4-fluoro-5-iodobenzoate. InChIKey: LNUXMWOMFBQQLR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7FINO2
Molecular weight295.05 g/mol
IUPAC namemethyl 3-amino-4-fluoro-5-iodobenzoate
InChIKeyLNUXMWOMFBQQLR-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C(=C1)I)F)N

Computed by PubChem (NCBI)