CAS 1260845-74-6 appears in our catalog under these names: (R)-3-Fluoro-5-(pyrrolidin-2-yl)pyridine dihydrochloride, 95%, (R)–3–FLUORO–5–(PYRROLIDIN–2–YL)PYRIDINE 2HCL. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
3-fluoro-5-[(2R)-pyrrolidin-2-yl]pyridine;dihydrochloride (CAS 1260845-74-6) is a chemical compound with the molecular formula C9H13Cl2FN2 and a molecular weight of 239.11 g/mol. IUPAC name: 3-fluoro-5-[(2R)-pyrrolidin-2-yl]pyridine;dihydrochloride. InChIKey: ZFFKBCBBODOTJG-KLQYNRQASA-N.
| Molecular formula | C9H13Cl2FN2 |
|---|---|
| Molecular weight | 239.11 g/mol |
| IUPAC name | 3-fluoro-5-[(2R)-pyrrolidin-2-yl]pyridine;dihydrochloride |
| InChIKey | ZFFKBCBBODOTJG-KLQYNRQASA-N |
| SMILES | C1C[C@@H](NC1)C2=CC(=CN=C2)F.Cl.Cl |
Computed by PubChem (NCBI)