CAS 2197053-33-9 is the registry number for Cyclopropyl(2-fluoropyridin-4-yl)methanamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Cyclopropyl-(2-fluoro-4-pyridinyl)methanamine;dihydrochloride (CAS 2197053-33-9) is a chemical compound with the molecular formula C9H13Cl2FN2 and a molecular weight of 239.11 g/mol. IUPAC name: cyclopropyl-(2-fluoro-4-pyridinyl)methanamine;dihydrochloride. InChIKey: FGJPCNGNSZRRLP-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2FN2 |
|---|---|
| Molecular weight | 239.11 g/mol |
| IUPAC name | cyclopropyl-(2-fluoro-4-pyridinyl)methanamine;dihydrochloride |
| InChIKey | FGJPCNGNSZRRLP-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=CC(=NC=C2)F)N.Cl.Cl |
Computed by PubChem (NCBI)