CAS 2241594-20-5 appears in our catalog under these names: (S)-Cyclopropyl(6-fluoropyridin-2-yl)methanamine dihydrochloride, 95%, (S)–Cyclopropyl(6–fluoropyridin–2–yl)methanamine dihydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
(S)-cyclopropyl-(6-fluoro-2-pyridinyl)methanamine;dihydrochloride (CAS 2241594-20-5) is a chemical compound with the molecular formula C9H13Cl2FN2 and a molecular weight of 239.11 g/mol. IUPAC name: (S)-cyclopropyl-(6-fluoro-2-pyridinyl)methanamine;dihydrochloride. InChIKey: DSOUNGFOMMVHSE-WWPIYYJJSA-N.
| Molecular formula | C9H13Cl2FN2 |
|---|---|
| Molecular weight | 239.11 g/mol |
| IUPAC name | (S)-cyclopropyl-(6-fluoro-2-pyridinyl)methanamine;dihydrochloride |
| InChIKey | DSOUNGFOMMVHSE-WWPIYYJJSA-N |
| SMILES | C1CC1[C@@H](C2=NC(=CC=C2)F)N.Cl.Cl |
Computed by PubChem (NCBI)