CAS 1260849-11-3 is the registry number for Ethyl 2–bromo–5–fluorobenzimidate. Offered by: GLPBio. Available pack sizes: 1g, 5g.
Ethyl 2-bromo-5-fluorobenzenecarboximidate (CAS 1260849-11-3) is a chemical compound with the molecular formula C9H9BrFNO and a molecular weight of 246.08 g/mol. IUPAC name: ethyl 2-bromo-5-fluorobenzenecarboximidate. InChIKey: GYQXSPAECTUWLL-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFNO |
|---|---|
| Molecular weight | 246.08 g/mol |
| IUPAC name | ethyl 2-bromo-5-fluorobenzenecarboximidate |
| InChIKey | GYQXSPAECTUWLL-UHFFFAOYSA-N |
| SMILES | CCOC(=N)C1=C(C=CC(=C1)F)Br |
Computed by PubChem (NCBI)