Products 1260853-84-6
CAS 1260853-84-6 is the registry number for 1-(3-Fluoro-4-methoxyphenyl)-1H-pyrazole, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
1-(3-fluoro-4-methoxyphenyl)pyrazole (CAS 1260853-84-6) is a chemical compound with the molecular formula C10H9FN2O and a molecular weight of 192.19 g/mol. IUPAC name: 1-(3-fluoro-4-methoxyphenyl)pyrazole. InChIKey: MUVSTWPCDGHHLN-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2O |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | 1-(3-fluoro-4-methoxyphenyl)pyrazole |
| InChIKey | MUVSTWPCDGHHLN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N2C=CC=N2)F |
Computed by PubChem (NCBI)