Products 126088-20-8

CAS 126088-20-8 is the registry number for 6-Chloro-2-(4-chlorophenyl)-4-quinoline carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

6-chloro-2-(4-chlorophenyl)quinoline-4-carboxylic acid (CAS 126088-20-8) is a chemical compound with the molecular formula C16H9Cl2NO2 and a molecular weight of 318.2 g/mol. IUPAC name: 6-chloro-2-(4-chlorophenyl)quinoline-4-carboxylic acid. InChIKey: ICGJQZNTTPOWLN-UHFFFAOYSA-N.

Identity
Molecular formulaC16H9Cl2NO2
Molecular weight318.2 g/mol
IUPAC name6-chloro-2-(4-chlorophenyl)quinoline-4-carboxylic acid
InChIKeyICGJQZNTTPOWLN-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=NC3=C(C=C(C=C3)Cl)C(=C2)C(=O)O)Cl

Computed by PubChem (NCBI)