CAS 148887-61-0 appears in our catalog under these names: 2-(3,4-Dichlorophenyl)quinoline-4-carboxylic acid, 95%, 2-(3,4-Dichlorophenyl)quinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(3,4-dichlorophenyl)quinoline-4-carboxylic acid (CAS 148887-61-0) is a chemical compound with the molecular formula C16H9Cl2NO2 and a molecular weight of 318.2 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)quinoline-4-carboxylic acid. InChIKey: METUEFNOMUIMQR-UHFFFAOYSA-N.
| Molecular formula | C16H9Cl2NO2 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)quinoline-4-carboxylic acid |
| InChIKey | METUEFNOMUIMQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=CC(=C(C=C3)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)