Products 78872-37-4
CAS 78872-37-4 is the registry number for 2-(((3,5-dichlorophenyl)amino)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(3,5-dichlorophenyl)iminomethyl]-3-hydroxyinden-1-one (CAS 78872-37-4) is a chemical compound with the molecular formula C16H9Cl2NO2 and a molecular weight of 318.2 g/mol. IUPAC name: 2-[(3,5-dichlorophenyl)iminomethyl]-3-hydroxyinden-1-one. InChIKey: DSRCYOZVFSYSRF-UHFFFAOYSA-N.
| Molecular formula | C16H9Cl2NO2 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | 2-[(3,5-dichlorophenyl)iminomethyl]-3-hydroxyinden-1-one |
| InChIKey | DSRCYOZVFSYSRF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C2=O)C=NC3=CC(=CC(=C3)Cl)Cl)O |
Computed by PubChem (NCBI)