CAS 1260894-34-5 is the registry number for 4-(2-Oxopiperidin-1-yl)-2-(trifluoromethyl)benzaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2-oxopiperidin-1-yl)-2-(trifluoromethyl)benzaldehyde (CAS 1260894-34-5) is a chemical compound with the molecular formula C13H12F3NO2 and a molecular weight of 271.23 g/mol. IUPAC name: 4-(2-oxopiperidin-1-yl)-2-(trifluoromethyl)benzaldehyde. InChIKey: HIQHMRIDQQMSFR-UHFFFAOYSA-N.
| Molecular formula | C13H12F3NO2 |
|---|---|
| Molecular weight | 271.23 g/mol |
| IUPAC name | 4-(2-oxopiperidin-1-yl)-2-(trifluoromethyl)benzaldehyde |
| InChIKey | HIQHMRIDQQMSFR-UHFFFAOYSA-N |
| SMILES | C1CCN(C(=O)C1)C2=CC(=C(C=C2)C=O)C(F)(F)F |
Computed by PubChem (NCBI)