CAS 2197056-51-0 is the registry number for 6-(Trifluoromethyl)-1h-spiro[indole-3,4'-oxane]-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
6-(trifluoromethyl)spiro[1H-indole-3,4'-oxane]-2-one (CAS 2197056-51-0) is a chemical compound with the molecular formula C13H12F3NO2 and a molecular weight of 271.23 g/mol. IUPAC name: 6-(trifluoromethyl)spiro[1H-indole-3,4'-oxane]-2-one. InChIKey: YBHXNPHOONIJQJ-UHFFFAOYSA-N.
| Molecular formula | C13H12F3NO2 |
|---|---|
| Molecular weight | 271.23 g/mol |
| IUPAC name | 6-(trifluoromethyl)spiro[1H-indole-3,4'-oxane]-2-one |
| InChIKey | YBHXNPHOONIJQJ-UHFFFAOYSA-N |
| SMILES | C1COCCC12C3=C(C=C(C=C3)C(F)(F)F)NC2=O |
Computed by PubChem (NCBI)