CAS 2379928-12-6 is the registry number for 6-(Trifluoromethyl)-2H-spiro[benzofuran-3,4'-piperidin]-2'-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-2'-one (CAS 2379928-12-6) is a chemical compound with the molecular formula C13H12F3NO2 and a molecular weight of 271.23 g/mol. IUPAC name: 6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-2'-one. InChIKey: ABDVOIZKESPMEU-UHFFFAOYSA-N.
| Molecular formula | C13H12F3NO2 |
|---|---|
| Molecular weight | 271.23 g/mol |
| IUPAC name | 6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-2'-one |
| InChIKey | ABDVOIZKESPMEU-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)CC12COC3=C2C=CC(=C3)C(F)(F)F |
Computed by PubChem (NCBI)