CAS 2377417-97-3 is the registry number for 6'-(Trifluoromethyl)-2'H-spiro[cyclohexane-1,3'-furo[2,3-b]pyridin]-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(trifluoromethyl)spiro[2H-furo[2,3-b]pyridine-3,4'-cyclohexane]-1'-one (CAS 2377417-97-3) is a chemical compound with the molecular formula C13H12F3NO2 and a molecular weight of 271.23 g/mol. IUPAC name: 6-(trifluoromethyl)spiro[2H-furo[2,3-b]pyridine-3,4'-cyclohexane]-1'-one. InChIKey: PVJAMBKIGWBFDU-UHFFFAOYSA-N.
| Molecular formula | C13H12F3NO2 |
|---|---|
| Molecular weight | 271.23 g/mol |
| IUPAC name | 6-(trifluoromethyl)spiro[2H-furo[2,3-b]pyridine-3,4'-cyclohexane]-1'-one |
| InChIKey | PVJAMBKIGWBFDU-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1=O)COC3=C2C=CC(=N3)C(F)(F)F |
Computed by PubChem (NCBI)