CAS 1260903-08-9 is the registry number for 3-Bromo-2,4,5-trifluorobenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
3-bromo-2,4,5-trifluorobenzaldehyde (CAS 1260903-08-9) is a chemical compound with the molecular formula C7H2BrF3O and a molecular weight of 238.99 g/mol. IUPAC name: 3-bromo-2,4,5-trifluorobenzaldehyde. InChIKey: HGUUTYGEGIOGOQ-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF3O |
|---|---|
| Molecular weight | 238.99 g/mol |
| IUPAC name | 3-bromo-2,4,5-trifluorobenzaldehyde |
| InChIKey | HGUUTYGEGIOGOQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)Br)F)C=O |
Computed by PubChem (NCBI)