CAS 137234-99-2 appears in our catalog under these names: 3-bromo-2,5,6-trifluorobenzaldehyde, 95%, 5-Bromo-2,3,6-trifluorobenzaldehyde, 95%, 5-BROMO-2,3,6-TRIFLUOROBENZALDEHYDE, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 50mg, 100mg.
3-bromo-2,5,6-trifluorobenzaldehyde (CAS 137234-99-2) is a chemical compound with the molecular formula C7H2BrF3O and a molecular weight of 238.99 g/mol. IUPAC name: 3-bromo-2,5,6-trifluorobenzaldehyde. InChIKey: IAZJZAXUIHMQGF-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF3O |
|---|---|
| Molecular weight | 238.99 g/mol |
| IUPAC name | 3-bromo-2,5,6-trifluorobenzaldehyde |
| InChIKey | IAZJZAXUIHMQGF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)C=O)F)F |
Computed by PubChem (NCBI)