CAS 537033-56-0 appears in our catalog under these names: 4-Bromo-2,3,6-trifluorobenzaldehyde, 95%, 4-Bromo-2,3,6-trifluorobenzaldehyde 95%, Benzaldehyde, 4-bromo-2,3,6-trifluoro-, 95%+, 95%+, 4-Bromo-2,3,6-trifluorobenzaldehyde, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 500mg.
4-bromo-2,3,6-trifluorobenzaldehyde (CAS 537033-56-0) is a chemical compound with the molecular formula C7H2BrF3O and a molecular weight of 238.99 g/mol. IUPAC name: 4-bromo-2,3,6-trifluorobenzaldehyde. InChIKey: LYPYTFIWASJIRU-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF3O |
|---|---|
| Molecular weight | 238.99 g/mol |
| IUPAC name | 4-bromo-2,3,6-trifluorobenzaldehyde |
| InChIKey | LYPYTFIWASJIRU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)F)C=O)F |
Computed by PubChem (NCBI)