CAS 1260913-40-3 is the registry number for 7,8-Dichloro-3-isoquinolinamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7,8-dichloroisoquinolin-3-amine (CAS 1260913-40-3) is a chemical compound with the molecular formula C9H6Cl2N2 and a molecular weight of 213.06 g/mol. IUPAC name: 7,8-dichloroisoquinolin-3-amine. InChIKey: NMLCOJWIGQAXBM-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2 |
|---|---|
| Molecular weight | 213.06 g/mol |
| IUPAC name | 7,8-dichloroisoquinolin-3-amine |
| InChIKey | NMLCOJWIGQAXBM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=CN=C(C=C21)N)Cl)Cl |
Computed by PubChem (NCBI)