CAS 1242336-72-6 is the registry number for 1-(2,6-Dichlorophenyl)-1H-pyrazole, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(2,6-dichlorophenyl)pyrazole (CAS 1242336-72-6) is a chemical compound with the molecular formula C9H6Cl2N2 and a molecular weight of 213.06 g/mol. IUPAC name: 1-(2,6-dichlorophenyl)pyrazole. InChIKey: ISWDZQBZQFCRIN-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2 |
|---|---|
| Molecular weight | 213.06 g/mol |
| IUPAC name | 1-(2,6-dichlorophenyl)pyrazole |
| InChIKey | ISWDZQBZQFCRIN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N2C=CC=N2)Cl |
Computed by PubChem (NCBI)