CAS 1414786-90-5 appears in our catalog under these names: 2,4-Dichloroquinolin-3-amine, 95%, 2,4-Dichloroquinolin-3-amine 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 250mg, 100mg, 5g, 1g.
2,4-dichloroquinolin-3-amine (CAS 1414786-90-5) is a chemical compound with the molecular formula C9H6Cl2N2 and a molecular weight of 213.06 g/mol. IUPAC name: 2,4-dichloroquinolin-3-amine. InChIKey: HTKUTHCPGCVCMT-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2 |
|---|---|
| Molecular weight | 213.06 g/mol |
| IUPAC name | 2,4-dichloroquinolin-3-amine |
| InChIKey | HTKUTHCPGCVCMT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C(=N2)Cl)N)Cl |
Computed by PubChem (NCBI)