CAS 948293-25-2 appears in our catalog under these names: 4-Amino-7,8-dichloroquinoline, 95%, 7,8-Dichloroquinolin-4-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
7,8-dichloroquinolin-4-amine (CAS 948293-25-2) is a chemical compound with the molecular formula C9H6Cl2N2 and a molecular weight of 213.06 g/mol. IUPAC name: 7,8-dichloroquinolin-4-amine. InChIKey: LTNLLDGKTSLFRZ-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2 |
|---|---|
| Molecular weight | 213.06 g/mol |
| IUPAC name | 7,8-dichloroquinolin-4-amine |
| InChIKey | LTNLLDGKTSLFRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=NC=CC(=C21)N)Cl)Cl |
Computed by PubChem (NCBI)