CAS 1260926-46-2 is the registry number for 1-([1-(4-Methylphenyl)-1h-1,2,3-triazol-4-yl]carbonyl)piperidin-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 5g.
(4-aminopiperidin-1-yl)-[1-(4-methylphenyl)triazol-4-yl]methanone (CAS 1260926-46-2) is a chemical compound with the molecular formula C15H19N5O and a molecular weight of 285.34 g/mol. IUPAC name: (4-aminopiperidin-1-yl)-[1-(4-methylphenyl)triazol-4-yl]methanone. InChIKey: DFXUOYMHTJTJKX-UHFFFAOYSA-N.
| Molecular formula | C15H19N5O |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | (4-aminopiperidin-1-yl)-[1-(4-methylphenyl)triazol-4-yl]methanone |
| InChIKey | DFXUOYMHTJTJKX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C=C(N=N2)C(=O)N3CCC(CC3)N |
Computed by PubChem (NCBI)