Products 260435-42-5
CAS 260435-42-5 appears in our catalog under these names: Rizatriptan N–oxide, Rizatriptan n10-oxide, 95%, Rizatriptan EP Impurity H (Rizatriptan N-Oxide), N,N-Dimethyl-2-(5-(1H-1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl)ethanamine N-Oxide (Rizatriptan N-Oxide), Rizatriptan N10-Oxide, >95% (HPLC). Offered by: GLPBio, Combi-blocks, Chemat Brand, Mikromol, TRC. Available pack sizes: 5mg, 250mg, 500mg, on request, 100mg, 10mg, 25mg, 1mg.
N,N-dimethyl-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethanamine oxide (CAS 260435-42-5) is a chemical compound with the molecular formula C15H19N5O and a molecular weight of 285.34 g/mol. IUPAC name: N,N-dimethyl-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethanamine oxide. InChIKey: DQTBNOJGXNZYDG-UHFFFAOYSA-N.
| Molecular formula | C15H19N5O |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | N,N-dimethyl-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethanamine oxide |
| InChIKey | DQTBNOJGXNZYDG-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCC1=CNC2=C1C=C(C=C2)CN3C=NC=N3)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Rizatriptan N-oxide, Rizatriptan benzoate impurity H [EP], 1H-Indole-3-ethanamine, N,N-dimethyl-5-(1H-1,2,4-triazol-1-ylmethyl)-, N-oxide, N,N-Dimethyl-2-(5-(1H-1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl)ethanamine N-oxide, RIZATRIPTAN BENZOATE IMPURITY H [EP IMPURITY], RIZATRIPTAN BENZOATE IMPURITY H (EP IMPURITY), Rizatriptan benzoate impurity H, Rizatriptan N10-Oxide, Rizatriptan N10-Oxide-d6, Rizatriptan EP Impurity H