CAS 351190-36-8 is the registry number for N-(4,6-Dimethylpyrimidin-2-yl)-n'-(2-ethoxyphenyl)guanidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4,6-dimethylpyrimidin-2-yl)-1-(2-ethoxyphenyl)guanidine (CAS 351190-36-8) is a chemical compound with the molecular formula C15H19N5O and a molecular weight of 285.34 g/mol. IUPAC name: 2-(4,6-dimethylpyrimidin-2-yl)-1-(2-ethoxyphenyl)guanidine. InChIKey: TXIGPGZVKCDYGZ-UHFFFAOYSA-N.
| Molecular formula | C15H19N5O |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | 2-(4,6-dimethylpyrimidin-2-yl)-1-(2-ethoxyphenyl)guanidine |
| InChIKey | TXIGPGZVKCDYGZ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC=C1N/C(=N/C2=NC(=CC(=N2)C)C)/N |
Computed by PubChem (NCBI)