CAS 126111-14-6 is the registry number for (S)-Methyl 4,4-difluoropyrrolidine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
Methyl (2S)-4,4-difluoropyrrolidine-2-carboxylate (CAS 126111-14-6) is a chemical compound with the molecular formula C6H9F2NO2 and a molecular weight of 165.14 g/mol. IUPAC name: methyl (2S)-4,4-difluoropyrrolidine-2-carboxylate. InChIKey: RPYSGPRTWAWWKK-BYPYZUCNSA-N.
| Molecular formula | C6H9F2NO2 |
|---|---|
| Molecular weight | 165.14 g/mol |
| IUPAC name | methyl (2S)-4,4-difluoropyrrolidine-2-carboxylate |
| InChIKey | RPYSGPRTWAWWKK-BYPYZUCNSA-N |
| SMILES | COC(=O)[C@@H]1CC(CN1)(F)F |
Computed by PubChem (NCBI)