CAS 193353-30-9 is the registry number for Rel-(1R,2S)-2-amino-4,4-difluorocyclopentane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1R,2S)-2-amino-4,4-difluorocyclopentane-1-carboxylic acid (CAS 193353-30-9) is a chemical compound with the molecular formula C6H9F2NO2 and a molecular weight of 165.14 g/mol. IUPAC name: cis-(1R,2S)-2-amino-4,4-difluorocyclopentane-1-carboxylic acid. InChIKey: SOBKXLAGVGFGCU-DMTCNVIQSA-N.
| Molecular formula | C6H9F2NO2 |
|---|---|
| Molecular weight | 165.14 g/mol |
| IUPAC name | cis-(1R,2S)-2-amino-4,4-difluorocyclopentane-1-carboxylic acid |
| InChIKey | SOBKXLAGVGFGCU-DMTCNVIQSA-N |
| SMILES | C1[C@H]([C@H](CC1(F)F)N)C(=O)O |
Computed by PubChem (NCBI)