Products 193353-30-9

CAS 193353-30-9 is the registry number for Rel-(1R,2S)-2-amino-4,4-difluorocyclopentane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Cis-(1R,2S)-2-amino-4,4-difluorocyclopentane-1-carboxylic acid (CAS 193353-30-9) is a chemical compound with the molecular formula C6H9F2NO2 and a molecular weight of 165.14 g/mol. IUPAC name: cis-(1R,2S)-2-amino-4,4-difluorocyclopentane-1-carboxylic acid. InChIKey: SOBKXLAGVGFGCU-DMTCNVIQSA-N.

Identity
Molecular formulaC6H9F2NO2
Molecular weight165.14 g/mol
IUPAC namecis-(1R,2S)-2-amino-4,4-difluorocyclopentane-1-carboxylic acid
InChIKeySOBKXLAGVGFGCU-DMTCNVIQSA-N
SMILESC1[C@H]([C@H](CC1(F)F)N)C(=O)O

Computed by PubChem (NCBI)