CAS 2172592-43-5 is the registry number for 1,1-Difluoro-4-nitrocyclohexane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1,1-difluoro-4-nitrocyclohexane (CAS 2172592-43-5) is a chemical compound with the molecular formula C6H9F2NO2 and a molecular weight of 165.14 g/mol. IUPAC name: 1,1-difluoro-4-nitrocyclohexane. InChIKey: CZQIPBMHGUJBQY-UHFFFAOYSA-N.
| Molecular formula | C6H9F2NO2 |
|---|---|
| Molecular weight | 165.14 g/mol |
| IUPAC name | 1,1-difluoro-4-nitrocyclohexane |
| InChIKey | CZQIPBMHGUJBQY-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1[N+](=O)[O-])(F)F |
Computed by PubChem (NCBI)