Products 126113-24-4
CAS 126113-24-4 appears in our catalog under these names: 3-(4-Hydroxynaphthalen-1-yl)-1-phenylpropan-1-one, 95%, Dapoxetine Impurity 16. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-(4-hydroxynaphthalen-1-yl)-1-phenylpropan-1-one (CAS 126113-24-4) is a chemical compound with the molecular formula C19H16O2 and a molecular weight of 276.3 g/mol. IUPAC name: 3-(4-hydroxynaphthalen-1-yl)-1-phenylpropan-1-one. InChIKey: LMPNYKWOEJVKKV-UHFFFAOYSA-N.
| Molecular formula | C19H16O2 |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | 3-(4-hydroxynaphthalen-1-yl)-1-phenylpropan-1-one |
| InChIKey | LMPNYKWOEJVKKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CCC2=CC=C(C3=CC=CC=C23)O |
Computed by PubChem (NCBI)