CAS 512828-08-9 is the registry number for 1,3-Bis(4-vinylphenyl)propane-1,3-dione, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-bis(4-ethenylphenyl)propane-1,3-dione (CAS 512828-08-9) is a chemical compound with the molecular formula C19H16O2 and a molecular weight of 276.3 g/mol. IUPAC name: 1,3-bis(4-ethenylphenyl)propane-1,3-dione. InChIKey: SHMTWOSKHSFTSM-UHFFFAOYSA-N.
| Molecular formula | C19H16O2 |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | 1,3-bis(4-ethenylphenyl)propane-1,3-dione |
| InChIKey | SHMTWOSKHSFTSM-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)C(=O)CC(=O)C2=CC=C(C=C2)C=C |
Computed by PubChem (NCBI)