Products 94305-39-2

CAS 94305-39-2 is the registry number for 3-(Naphthalen-2-yl)-2-phenylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-naphthalen-2-yl-2-phenylpropanoic acid (CAS 94305-39-2) is a chemical compound with the molecular formula C19H16O2 and a molecular weight of 276.3 g/mol. IUPAC name: 3-naphthalen-2-yl-2-phenylpropanoic acid. InChIKey: JLLIWQLPMBUYJR-UHFFFAOYSA-N.

Identity
Molecular formulaC19H16O2
Molecular weight276.3 g/mol
IUPAC name3-naphthalen-2-yl-2-phenylpropanoic acid
InChIKeyJLLIWQLPMBUYJR-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(CC2=CC3=CC=CC=C3C=C2)C(=O)O

Computed by PubChem (NCBI)