Products 1261170-81-3
CAS 1261170-81-3 appears in our catalog under these names: FERULIC ACID-1,2,3-13C3, 99 ATOM % 13C,&, Ferulic acid-13C3, 98.3%. Offered by: Sigma-Aldrich, MedChemExpress. Available pack sizes: 1MG, 5MG, 1 mg.
(E)-3-(4-hydroxy-3-methoxy(1,2,3-13C3)cyclohexa-1,3,5-trien-1-yl)prop-2-enoic acid (CAS 1261170-81-3) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 197.16 g/mol. IUPAC name: (E)-3-(4-hydroxy-3-methoxy(1,2,3-13C3)cyclohexa-1,3,5-trien-1-yl)prop-2-enoic acid. InChIKey: KSEBMYQBYZTDHS-YXBKIRPPSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 197.16 g/mol |
| IUPAC name | (E)-3-(4-hydroxy-3-methoxy(1,2,3-13C3)cyclohexa-1,3,5-trien-1-yl)prop-2-enoic acid |
| InChIKey | KSEBMYQBYZTDHS-YXBKIRPPSA-N |
| SMILES | CO[13C]1=C(C=C[13C](=[13CH]1)/C=C/C(=O)O)O |
Computed by PubChem (NCBI)