Products 860605-59-0
CAS 860605-59-0 appears in our catalog under these names: Ferulic Acid-d3, >95% (HPLC), trans-4-Hydroxy-3-methoxy-d3-cinnamic Acid, 99 atom % D, min 98% Chemical Purity, (E)–Ferulic acid–d3, (E)-Ferulic acid-d3, 99.76%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,01g, 0,005g, 5mg, 5 mg, 10 mg, 1 mg.
(E)-3-[4-hydroxy-3-(trideuteriomethoxy)phenyl]prop-2-enoic acid (CAS 860605-59-0) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 197.20 g/mol. IUPAC name: (E)-3-[4-hydroxy-3-(trideuteriomethoxy)phenyl]prop-2-enoic acid. InChIKey: KSEBMYQBYZTDHS-CGLOQUBRSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 197.20 g/mol |
| IUPAC name | (E)-3-[4-hydroxy-3-(trideuteriomethoxy)phenyl]prop-2-enoic acid |
| InChIKey | KSEBMYQBYZTDHS-CGLOQUBRSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)/C=C/C(=O)O)O |
Computed by PubChem (NCBI)