CAS 1261225-49-3 appears in our catalog under these names: Benzyl tert-butyl ((1R,3S)-cyclohexane-1,3-diyl)dicarbamate, 95%, benzyl tert-Butyl ((1R,3S)-cyclohexane-1,3-diyl)dicarbamate, 95%, 95%, benzyl tert-Butyl ((1S,3R)-cyclohexane-1,3-diyl)dicarbamate, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
Benzyl N-[(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamate (CAS 1261225-49-3) is a chemical compound with the molecular formula C19H28N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: benzyl N-[(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamate. InChIKey: WBCJCRHCNGJQOY-JKSUJKDBSA-N.
| Molecular formula | C19H28N2O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | benzyl N-[(1S,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamate |
| InChIKey | WBCJCRHCNGJQOY-JKSUJKDBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@@H](C1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)