Products 1298101-46-8
CAS 1298101-46-8 is the registry number for Benzyl N-[(1r,3r)-3-{[(tert-butoxy)carbonyl]amino}cyclohexyl]carbamate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Benzyl N-[(1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamate (CAS 1298101-46-8) is a chemical compound with the molecular formula C19H28N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: benzyl N-[(1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamate. InChIKey: WBCJCRHCNGJQOY-HZPDHXFCSA-N.
| Molecular formula | C19H28N2O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | benzyl N-[(1R,3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamate |
| InChIKey | WBCJCRHCNGJQOY-HZPDHXFCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](C1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)