Products 1261269-06-0
CAS 1261269-06-0 appears in our catalog under these names: 3-(1-Methyl-5-imidazolyl)benzoic acid, 95%, 3–(1–Methyl–5–imidazolyl)benzoic Acid, 3-(1-Methyl-5-imidazolyl)benzoic acid, 3-(1-Methyl-1H-imidazol-5-yl)benzoic acid, 97%, 3-(1-Methyl-5-imidazolyl)benzoic Acid, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 0,5g, 50mg, 100mg, 250mg.
3-(3-methylimidazol-4-yl)benzoic acid (CAS 1261269-06-0) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 3-(3-methylimidazol-4-yl)benzoic acid. InChIKey: CCTCZHDQSJKDGB-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 3-(3-methylimidazol-4-yl)benzoic acid |
| InChIKey | CCTCZHDQSJKDGB-UHFFFAOYSA-N |
| SMILES | CN1C=NC=C1C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)