CAS 1261394-62-0 appears in our catalog under these names: Efavirenz-13C6, Efavirenz 13C6, (S)-Efavirenz-13C6. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 50mg, 1 mg.
6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (CAS 1261394-62-0) is a chemical compound with the molecular formula C14H9ClF3NO2 and a molecular weight of 321.63 g/mol. IUPAC name: 6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one. InChIKey: XPOQHMRABVBWPR-OMTIFVAJSA-N.
| Molecular formula | C14H9ClF3NO2 |
|---|---|
| Molecular weight | 321.63 g/mol |
| IUPAC name | 6-chloro-4-(2-cyclopropylethynyl)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| InChIKey | XPOQHMRABVBWPR-OMTIFVAJSA-N |
| SMILES | C1CC1C#CC2([13C]3=[13C]([13CH]=[13CH][13C](=[13CH]3)Cl)NC(=O)O2)C(F)(F)F |
Computed by PubChem (NCBI)