Products 1261598-96-2
CAS 1261598-96-2 is the registry number for Methyl 6-chloro-3-(4-(trifluoromethyl)phenyl)picolinate, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.
Methyl 6-chloro-3-[4-(trifluoromethyl)phenyl]pyridine-2-carboxylate (CAS 1261598-96-2) is a chemical compound with the molecular formula C14H9ClF3NO2 and a molecular weight of 315.67 g/mol. IUPAC name: methyl 6-chloro-3-[4-(trifluoromethyl)phenyl]pyridine-2-carboxylate. InChIKey: SLIFIVACMYULFH-UHFFFAOYSA-N.
| Molecular formula | C14H9ClF3NO2 |
|---|---|
| Molecular weight | 315.67 g/mol |
| IUPAC name | methyl 6-chloro-3-[4-(trifluoromethyl)phenyl]pyridine-2-carboxylate |
| InChIKey | SLIFIVACMYULFH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=N1)Cl)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)