CAS 217186-15-7 appears in our catalog under these names: 2-(4-Acetophenoxy)-3-chloro-5-(trifluoromethyl)pyridine, 95%, 2-(4-Acetophenoxy)-3-chloro-5-trifluoromethyl pyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 25g, 10g, 50g.
1-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]ethanone (CAS 217186-15-7) is a chemical compound with the molecular formula C14H9ClF3NO2 and a molecular weight of 315.67 g/mol. IUPAC name: 1-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]ethanone. InChIKey: KMIJSBTYRYODBD-UHFFFAOYSA-N.
| Molecular formula | C14H9ClF3NO2 |
|---|---|
| Molecular weight | 315.67 g/mol |
| IUPAC name | 1-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]ethanone |
| InChIKey | KMIJSBTYRYODBD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)OC2=C(C=C(C=N2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)