Products 1261395-28-1
CAS 1261395-28-1 appears in our catalog under these names: Omeprazole–13CD3, Omeprazole-13C-d3, Omeprazole (Benzimidazole 5-Methoxy-13CD3), Omeprazole-13C,d3, 98.00%. Offered by: GLPBio, Chemat Brand, TRC, MedChemExpress. Available pack sizes: 1mg, on request, 25mg, 5mg, 1 mg, 5 mg.
2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-(trideuterio(113C)methoxy)-1H-benzimidazole (CAS 1261395-28-1) is a chemical compound with the molecular formula C17H19N3O3S and a molecular weight of 349.4 g/mol. IUPAC name: 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-(trideuterio(113C)methoxy)-1H-benzimidazole. InChIKey: SUBDBMMJDZJVOS-LBDFIVMYSA-N.
| Molecular formula | C17H19N3O3S |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-(trideuterio(113C)methoxy)-1H-benzimidazole |
| InChIKey | SUBDBMMJDZJVOS-LBDFIVMYSA-N |
| SMILES | [2H][13C]([2H])([2H])OC1=CC2=C(C=C1)N=C(N2)S(=O)CC3=NC=C(C(=C3C)OC)C |
Computed by PubChem (NCBI)