CAS 934293-91-1 is the registry number for Omeprazole-d6. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 5mg, 1mg, 10mg, 50mg.
2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-(trideuteriomethoxy)-1H-benzimidazole (CAS 934293-91-1) is a chemical compound with the molecular formula C17H19N3O3S and a molecular weight of 348.4 g/mol. IUPAC name: 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-(trideuteriomethoxy)-1H-benzimidazole. InChIKey: SUBDBMMJDZJVOS-HPRDVNIFSA-N.
| Molecular formula | C17H19N3O3S |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-(trideuteriomethoxy)-1H-benzimidazole |
| InChIKey | SUBDBMMJDZJVOS-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC2=C(C=C1)N=C(N2)S(=O)CC3=NC=C(C(=C3C)OC)C |
Computed by PubChem (NCBI)