Products 922731-01-9
CAS 922731-01-9 appears in our catalog under these names: Omeprazole-d3, >95% (HPLC), Omeprazole-d3, Omeprazole-d3, 98.99%. Offered by: TRC, TargetMol, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 5 mg, 10 mg, 1 mg, 10mM/1mL.
2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-(trideuteriomethoxy)-1H-benzimidazole (CAS 922731-01-9) is a chemical compound with the molecular formula C17H19N3O3S and a molecular weight of 348.4 g/mol. IUPAC name: 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-(trideuteriomethoxy)-1H-benzimidazole. InChIKey: SUBDBMMJDZJVOS-HPRDVNIFSA-N.
| Molecular formula | C17H19N3O3S |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 2-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]-6-(trideuteriomethoxy)-1H-benzimidazole |
| InChIKey | SUBDBMMJDZJVOS-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC2=C(C=C1)N=C(N2)S(=O)CC3=NC=C(C(=C3C)OC)C |
Computed by PubChem (NCBI)